C22H32OP2 — CID 71191488
4-methyl-2-[3-[2-methyl-6-(methylphosphanylmethyl)phenyl]phosphanylhexan-3-yl]phenol (PubChem CID 71191488) has the molecular formula C22H32OP2 and a molecular weight of 374.45 g/mol. Its IUPAC name is 4-methyl-2-[3-[2-methyl-6-(methylphosphanylmethyl)phenyl]phosphanylhexan-3-yl]phenol.
| Compound Name | 4-methyl-2-[3-[2-methyl-6-(methylphosphanylmethyl)phenyl]phosphanylhexan-3-yl]phenol |
|---|---|
| PubChem CID | 71191488 |
| Molecular Formula | C22H32OP2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-methyl-2-[3-[2-methyl-6-(methylphosphanylmethyl)phenyl]phosphanylhexan-3-yl]phenol |
| SMILES | CCCC(CC)(Pc1c(C)cccc1CPC)c1cc(C)ccc1O |
| InChI | InChI=1S/C22H32OP2/c1-6-13-22(7-2,19-14-16(3)11-12-20(19)23)25-21-17(4)9-8-10-18(21)15-24-5/h8-12,14,23-25H,6-7,13,15H2,1-5H3 |
| InChIKey | QOWWJNPJMGCTMO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|