C23H34O2P2 — CID 88969386
[2-[3-[2-(methoxymethoxy)-3-methylphenyl]pentan-3-ylphosphanyl]-3-methylphenyl]-dimethylphosphane (PubChem CID 88969386) has the molecular formula C23H34O2P2 and a molecular weight of 404.47 g/mol. Its IUPAC name is [2-[3-[2-(methoxymethoxy)-3-methylphenyl]pentan-3-ylphosphanyl]-3-methylphenyl]-dimethylphosphane.
| Compound Name | [2-[3-[2-(methoxymethoxy)-3-methylphenyl]pentan-3-ylphosphanyl]-3-methylphenyl]-dimethylphosphane |
|---|---|
| PubChem CID | 88969386 |
| Molecular Formula | C23H34O2P2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [2-[3-[2-(methoxymethoxy)-3-methylphenyl]pentan-3-ylphosphanyl]-3-methylphenyl]-dimethylphosphane |
| SMILES | CCC(CC)(Pc1c(C)cccc1P(C)C)c1cccc(C)c1OCOC |
| InChI | InChI=1S/C23H34O2P2/c1-8-23(9-2,19-14-10-12-17(3)21(19)25-16-24-5)26-22-18(4)13-11-15-20(22)27(6)7/h10-15,26H,8-9,16H2,1-7H3 |
| InChIKey | RFVXHYNRNKPSRR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|