C21H27O4P — CID 88969314
2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]-3-methylbenzaldehyde (PubChem CID 88969314) has the molecular formula C21H27O4P and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]-3-methylbenzaldehyde.
| Compound Name | 2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 88969314 |
| Molecular Formula | C21H27O4P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]-3-methylbenzaldehyde |
| SMILES | CCC(C)(Pc1c(C)cccc1C=O)c1cccc(OC)c1OCOC |
| InChI | InChI=1S/C21H27O4P/c1-6-21(3,26-20-15(2)9-7-10-16(20)13-22)17-11-8-12-18(24-5)19(17)25-14-23-4/h7-13,26H,6,14H2,1-5H3 |
| InChIKey | ASJSGSASMASIDZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|