C31H50NOP — CID 88969322
2,4-ditert-butyl-6-[2-[2-methyl-6-[(propan-2-ylamino)methyl]phenyl]phosphanylhexan-2-yl]phenol (PubChem CID 88969322) has the molecular formula C31H50NOP and a molecular weight of 483.72 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[2-methyl-6-[(propan-2-ylamino)methyl]phenyl]phosphanylhexan-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-[2-methyl-6-[(propan-2-ylamino)methyl]phenyl]phosphanylhexan-2-yl]phenol |
|---|---|
| PubChem CID | 88969322 |
| Molecular Formula | C31H50NOP |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[2-methyl-6-[(propan-2-ylamino)methyl]phenyl]phosphanylhexan-2-yl]phenol |
| SMILES | CCCCC(C)(Pc1c(C)cccc1CNC(C)C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H50NOP/c1-12-13-17-31(11,34-28-22(4)15-14-16-23(28)20-32-21(2)3)26-19-24(29(5,6)7)18-25(27(26)33)30(8,9)10/h14-16,18-19,21,32-34H,12-13,17,20H2,1-11H3 |
| InChIKey | ZWLCOHRDXRDDJS-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|