C40H52NOP — CID 89356596
2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylheptan-2-yl]phenol (PubChem CID 89356596) has the molecular formula C40H52NOP and a molecular weight of 593.84 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylheptan-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylheptan-2-yl]phenol |
|---|---|
| PubChem CID | 89356596 |
| Molecular Formula | C40H52NOP |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylheptan-2-yl]phenol |
| SMILES | CCCCCC(C)(Pc1ccccc1CN(c1ccccc1)c1ccccc1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C40H52NOP/c1-9-10-19-26-40(8,35-28-31(38(2,3)4)27-34(37(35)42)39(5,6)7)43-36-25-18-17-20-30(36)29-41(32-21-13-11-14-22-32)33-23-15-12-16-24-33/h11-18,20-25,27-28,42-43H,9-10,19,26,29H2,1-8H3 |
| InChIKey | ZNRDFCIEOLWIFT-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|