C31H41O2P — CID 71191496
4-tert-butyl-2-[2-[2-[hydroxy(phenyl)methyl]phenyl]phosphanylheptan-2-yl]-6-methylphenol (PubChem CID 71191496) has the molecular formula C31H41O2P and a molecular weight of 476.64 g/mol. Its IUPAC name is 4-tert-butyl-2-[2-[2-[hydroxy(phenyl)methyl]phenyl]phosphanylheptan-2-yl]-6-methylphenol.
| Compound Name | 4-tert-butyl-2-[2-[2-[hydroxy(phenyl)methyl]phenyl]phosphanylheptan-2-yl]-6-methylphenol |
|---|---|
| PubChem CID | 71191496 |
| Molecular Formula | C31H41O2P |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 4-tert-butyl-2-[2-[2-[hydroxy(phenyl)methyl]phenyl]phosphanylheptan-2-yl]-6-methylphenol |
| SMILES | CCCCCC(C)(Pc1ccccc1C(O)c1ccccc1)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C31H41O2P/c1-7-8-14-19-31(6,26-21-24(30(3,4)5)20-22(2)28(26)32)34-27-18-13-12-17-25(27)29(33)23-15-10-9-11-16-23/h9-13,15-18,20-21,29,32-34H,7-8,14,19H2,1-6H3 |
| InChIKey | JLWOHAONDYUVNH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|