C33H53O2P — CID 89214506
4-tert-butyl-2-(2,3-dimethylheptan-2-yl)-6-[2-[2-(1-hydroxyethyl)phenyl]phosphanylhexan-2-yl]phenol (PubChem CID 89214506) has the molecular formula C33H53O2P and a molecular weight of 512.76 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,3-dimethylheptan-2-yl)-6-[2-[2-(1-hydroxyethyl)phenyl]phosphanylhexan-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-(2,3-dimethylheptan-2-yl)-6-[2-[2-(1-hydroxyethyl)phenyl]phosphanylhexan-2-yl]phenol |
|---|---|
| PubChem CID | 89214506 |
| Molecular Formula | C33H53O2P |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | 4-tert-butyl-2-(2,3-dimethylheptan-2-yl)-6-[2-[2-(1-hydroxyethyl)phenyl]phosphanylhexan-2-yl]phenol |
| SMILES | CCCCC(C)C(C)(C)c1cc(C(C)(C)C)cc(C(C)(CCCC)Pc2ccccc2C(C)O)c1O |
| InChI | InChI=1S/C33H53O2P/c1-11-13-17-23(3)32(8,9)27-21-25(31(5,6)7)22-28(30(27)35)33(10,20-14-12-2)36-29-19-16-15-18-26(29)24(4)34/h15-16,18-19,21-24,34-36H,11-14,17,20H2,1-10H3 |
| InChIKey | HRAYHKZAFLMYPR-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|