C39H50NOP — CID 88968948
2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylhexan-2-yl]phenol (PubChem CID 88968948) has the molecular formula C39H50NOP and a molecular weight of 579.81 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylhexan-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylhexan-2-yl]phenol |
|---|---|
| PubChem CID | 88968948 |
| Molecular Formula | C39H50NOP |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[2-[(N-phenylanilino)methyl]phenyl]phosphanylhexan-2-yl]phenol |
| SMILES | CCCCC(C)(Pc1ccccc1CN(c1ccccc1)c1ccccc1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C39H50NOP/c1-9-10-25-39(8,34-27-30(37(2,3)4)26-33(36(34)41)38(5,6)7)42-35-24-18-17-19-29(35)28-40(31-20-13-11-14-21-31)32-22-15-12-16-23-32/h11-24,26-27,41-42H,9-10,25,28H2,1-8H3 |
| InChIKey | JFVLDSPHHVGJNJ-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|