C30H48NOP — CID 89356376
2,4-ditert-butyl-6-[2-[2-[[ethyl(methyl)amino]methyl]-6-methylphenyl]phosphanylpentan-2-yl]phenol (PubChem CID 89356376) has the molecular formula C30H48NOP and a molecular weight of 469.69 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[2-[[ethyl(methyl)amino]methyl]-6-methylphenyl]phosphanylpentan-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-[2-[[ethyl(methyl)amino]methyl]-6-methylphenyl]phosphanylpentan-2-yl]phenol |
|---|---|
| PubChem CID | 89356376 |
| Molecular Formula | C30H48NOP |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.35 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[2-[[ethyl(methyl)amino]methyl]-6-methylphenyl]phosphanylpentan-2-yl]phenol |
| SMILES | CCCC(C)(Pc1c(C)cccc1CN(C)CC)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H48NOP/c1-12-17-30(10,33-27-21(3)15-14-16-22(27)20-31(11)13-2)25-19-23(28(4,5)6)18-24(26(25)32)29(7,8)9/h14-16,18-19,32-33H,12-13,17,20H2,1-11H3 |
| InChIKey | GVXDPBCCJTVZBD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|