C36H52NOP — CID 89356307
2-[3-[2-(anilinomethyl)-4-methylphenyl]phosphanyloctan-3-yl]-4,6-ditert-butylphenol (PubChem CID 89356307) has the molecular formula C36H52NOP and a molecular weight of 545.79 g/mol. Its IUPAC name is 2-[3-[2-(anilinomethyl)-4-methylphenyl]phosphanyloctan-3-yl]-4,6-ditert-butylphenol.
| Compound Name | 2-[3-[2-(anilinomethyl)-4-methylphenyl]phosphanyloctan-3-yl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 89356307 |
| Molecular Formula | C36H52NOP |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 545.38 |
| IUPAC Name | 2-[3-[2-(anilinomethyl)-4-methylphenyl]phosphanyloctan-3-yl]-4,6-ditert-butylphenol |
| SMILES | CCCCCC(CC)(Pc1ccc(C)cc1CNc1ccccc1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C36H52NOP/c1-10-12-16-21-36(11-2,31-24-28(34(4,5)6)23-30(33(31)38)35(7,8)9)39-32-20-19-26(3)22-27(32)25-37-29-17-14-13-15-18-29/h13-15,17-20,22-24,37-39H,10-12,16,21,25H2,1-9H3 |
| InChIKey | JZXNABDQPGYETL-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|