C25H37OPS — CID 89214508
4-tert-butyl-2-methyl-6-[2-[2-(1-sulfanylethyl)phenyl]phosphanylhexan-2-yl]phenol (PubChem CID 89214508) has the molecular formula C25H37OPS and a molecular weight of 416.61 g/mol. Its IUPAC name is 4-tert-butyl-2-methyl-6-[2-[2-(1-sulfanylethyl)phenyl]phosphanylhexan-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-methyl-6-[2-[2-(1-sulfanylethyl)phenyl]phosphanylhexan-2-yl]phenol |
|---|---|
| PubChem CID | 89214508 |
| Molecular Formula | C25H37OPS |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-tert-butyl-2-methyl-6-[2-[2-(1-sulfanylethyl)phenyl]phosphanylhexan-2-yl]phenol |
| SMILES | CCCCC(C)(Pc1ccccc1C(C)S)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C25H37OPS/c1-8-9-14-25(7,27-22-13-11-10-12-20(22)18(3)28)21-16-19(24(4,5)6)15-17(2)23(21)26/h10-13,15-16,18,26-28H,8-9,14H2,1-7H3 |
| InChIKey | MLEALBUMIMJCPM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|