C27H41OPS — CID 88968987
4-tert-butyl-2-methyl-6-[2-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylheptan-2-yl]phenol (PubChem CID 88968987) has the molecular formula C27H41OPS and a molecular weight of 444.67 g/mol. Its IUPAC name is 4-tert-butyl-2-methyl-6-[2-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylheptan-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-methyl-6-[2-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylheptan-2-yl]phenol |
|---|---|
| PubChem CID | 88968987 |
| Molecular Formula | C27H41OPS |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 4-tert-butyl-2-methyl-6-[2-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylheptan-2-yl]phenol |
| SMILES | CCCCCC(C)(Pc1ccc(C)cc1C(C)S)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C27H41OPS/c1-9-10-11-14-27(8,29-24-13-12-18(2)15-22(24)20(4)30)23-17-21(26(5,6)7)16-19(3)25(23)28/h12-13,15-17,20,28-30H,9-11,14H2,1-8H3 |
| InChIKey | QKUHNJSKCGSAIV-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|