C30H39O2P — CID 71191686
[2-[2-(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]phenyl]methanol (PubChem CID 71191686) has the molecular formula C30H39O2P and a molecular weight of 462.61 g/mol. Its IUPAC name is [2-[2-(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]phenyl]methanol.
| Compound Name | [2-[2-(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]phenyl]methanol |
|---|---|
| PubChem CID | 71191686 |
| Molecular Formula | C30H39O2P |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | [2-[2-(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]phenyl]methanol |
| SMILES | CCCC(C)(Pc1ccccc1CO)c1cc(C)cc(C(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C30H39O2P/c1-7-17-30(6,33-27-16-12-11-15-24(27)20-31)26-19-22(2)18-25(29(3,4)5)28(26)32-21-23-13-9-8-10-14-23/h8-16,18-19,31,33H,7,17,20-21H2,1-6H3 |
| InChIKey | YLGVWSBAXHEFPC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|