C26H37O3P — CID 88987768
2-[2-[3-(2,3-dimethylpentan-2-yl)-2-(hydroxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]benzaldehyde (PubChem CID 88987768) has the molecular formula C26H37O3P and a molecular weight of 428.55 g/mol. Its IUPAC name is 2-[2-[3-(2,3-dimethylpentan-2-yl)-2-(hydroxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]benzaldehyde.
| Compound Name | 2-[2-[3-(2,3-dimethylpentan-2-yl)-2-(hydroxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]benzaldehyde |
|---|---|
| PubChem CID | 88987768 |
| Molecular Formula | C26H37O3P |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-[2-[3-(2,3-dimethylpentan-2-yl)-2-(hydroxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]benzaldehyde |
| SMILES | CCC(C)C(C)(C)c1cc(C)cc(C(C)(CC)Pc2ccccc2C=O)c1OCO |
| InChI | InChI=1S/C26H37O3P/c1-8-19(4)25(5,6)21-14-18(3)15-22(24(21)29-17-28)26(7,9-2)30-23-13-11-10-12-20(23)16-27/h10-16,19,28,30H,8-9,17H2,1-7H3 |
| InChIKey | PRJRKCFDPDFELS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|