C25H35O2P — CID 88968930
2-[3-(3-tert-butyl-2-methoxy-5-methylphenyl)pentan-3-ylphosphanyl]-5-methylbenzaldehyde (PubChem CID 88968930) has the molecular formula C25H35O2P and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-2-methoxy-5-methylphenyl)pentan-3-ylphosphanyl]-5-methylbenzaldehyde.
| Compound Name | 2-[3-(3-tert-butyl-2-methoxy-5-methylphenyl)pentan-3-ylphosphanyl]-5-methylbenzaldehyde |
|---|---|
| PubChem CID | 88968930 |
| Molecular Formula | C25H35O2P |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-[3-(3-tert-butyl-2-methoxy-5-methylphenyl)pentan-3-ylphosphanyl]-5-methylbenzaldehyde |
| SMILES | CCC(CC)(Pc1ccc(C)cc1C=O)c1cc(C)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C25H35O2P/c1-9-25(10-2,28-22-12-11-17(3)13-19(22)16-26)21-15-18(4)14-20(23(21)27-8)24(5,6)7/h11-16,28H,9-10H2,1-8H3 |
| InChIKey | XGZANRFKGDNBHF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|