C29H35O3P — CID 89214655
1-[2-[2-[5-benzyl-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-5-methylphenyl]ethanone (PubChem CID 89214655) has the molecular formula C29H35O3P and a molecular weight of 462.57 g/mol. Its IUPAC name is 1-[2-[2-[5-benzyl-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-5-methylphenyl]ethanone.
| Compound Name | 1-[2-[2-[5-benzyl-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-5-methylphenyl]ethanone |
|---|---|
| PubChem CID | 89214655 |
| Molecular Formula | C29H35O3P |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-[2-[2-[5-benzyl-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-5-methylphenyl]ethanone |
| SMILES | CCCC(C)(Pc1ccc(C)cc1C(C)=O)c1cc(Cc2ccccc2)ccc1OCOC |
| InChI | InChI=1S/C29H35O3P/c1-6-16-29(4,33-28-15-12-21(2)17-25(28)22(3)30)26-19-24(13-14-27(26)32-20-31-5)18-23-10-8-7-9-11-23/h7-15,17,19,33H,6,16,18,20H2,1-5H3 |
| InChIKey | XPGMFWAOVFVEAF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|