C26H38NOP — CID 163873282
2,4-ditert-butyl-6-[1-[4-methyl-2-(methyliminomethyl)phenyl]phosphanylpropyl]phenol (PubChem CID 163873282) has the molecular formula C26H38NOP and a molecular weight of 411.57 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-[4-methyl-2-(methyliminomethyl)phenyl]phosphanylpropyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[1-[4-methyl-2-(methyliminomethyl)phenyl]phosphanylpropyl]phenol |
|---|---|
| PubChem CID | 163873282 |
| Molecular Formula | C26H38NOP |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-[4-methyl-2-(methyliminomethyl)phenyl]phosphanylpropyl]phenol |
| SMILES | CCC(Pc1ccc(C)cc1/C=N/C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H38NOP/c1-10-22(29-23-12-11-17(2)13-18(23)16-27-9)20-14-19(25(3,4)5)15-21(24(20)28)26(6,7)8/h11-16,22,28-29H,10H2,1-9H3/b27-16+ |
| InChIKey | PMRMYICOTSGULW-JVWAILMASA-N |
| XLogP | 6.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|