C19H17F6NO — CID 171507515
1-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 171507515) has the molecular formula C19H17F6NO and a molecular weight of 389.34 g/mol. Its IUPAC name is 1-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 1-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 171507515 |
| Molecular Formula | C19H17F6NO |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | FC(F)(F)c1cc(N2CCCC2)c(OCc2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6NO/c20-18(21,22)14-10-15(19(23,24)25)17(16(11-14)26-8-4-5-9-26)27-12-13-6-2-1-3-7-13/h1-3,6-7,10-11H,4-5,8-9,12H2 |
| InChIKey | WRAQMTDIWBAHNO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |