C18H13F3O5 — CID 178077175
3-(1,3-dioxol-2-yl)-4-phenylmethoxy-5-(trifluoromethyl)benzoic acid (PubChem CID 178077175) has the molecular formula C18H13F3O5 and a molecular weight of 366.29 g/mol. Its IUPAC name is 3-(1,3-dioxol-2-yl)-4-phenylmethoxy-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(1,3-dioxol-2-yl)-4-phenylmethoxy-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 178077175 |
| Molecular Formula | C18H13F3O5 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-(1,3-dioxol-2-yl)-4-phenylmethoxy-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(C2OC=CO2)c(OCc2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F3O5/c19-18(20,21)14-9-12(16(22)23)8-13(17-24-6-7-25-17)15(14)26-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,22,23) |
| InChIKey | QWFLDDQCGWLOGA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |