C17H13BrO5 — CID 178077153
2-bromo-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid (PubChem CID 178077153) has the molecular formula C17H13BrO5 and a molecular weight of 377.19 g/mol. Its IUPAC name is 2-bromo-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid.
| Compound Name | 2-bromo-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 178077153 |
| Molecular Formula | C17H13BrO5 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 2-bromo-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid |
| SMILES | O=C(O)c1cc(C2OC=CO2)c(OCc2ccccc2)cc1Br |
| InChI | InChI=1S/C17H13BrO5/c18-14-9-15(23-10-11-4-2-1-3-5-11)13(8-12(14)16(19)20)17-21-6-7-22-17/h1-9,17H,10H2,(H,19,20) |
| InChIKey | NLHSJNJJHPNAOR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |