C21H16BrClO3 — CID 77174849
5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride (PubChem CID 77174849) has the molecular formula C21H16BrClO3 and a molecular weight of 431.71 g/mol. Its IUPAC name is 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride.
| Compound Name | 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride |
|---|---|
| PubChem CID | 77174849 |
| Molecular Formula | C21H16BrClO3 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride |
| SMILES | O=C(Cl)c1cc(Br)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H16BrClO3/c22-18-11-17(21(23)24)19(25-13-15-7-3-1-4-8-15)12-20(18)26-14-16-9-5-2-6-10-16/h1-12H,13-14H2 |
| InChIKey | FMHAKBRRLBRXRM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|