5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride

C21H16BrClO3 — CID 77174849

IUPAC5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride
SMILESO=C(Cl)c1cc(Br)c(OCc2ccccc2)cc1OCc1ccccc1
InChIInChI=1S/C21H16BrClO3/c22-18-11-17(21(23)24)19(25-13-15-7-3-1-4-8-15)12-20(18)26-14-16-9-5-2-6-10-16/h1-12H,13-14H2
InChIKeyFMHAKBRRLBRXRM-UHFFFAOYSA-N
MW431.71 g/mol
LogP5.99
Rot. Bonds7

About 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride

5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride (PubChem CID 77174849) has the molecular formula C21H16BrClO3 and a molecular weight of 431.71 g/mol. Its IUPAC name is 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride.

Molecular Properties

Compound Name5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride
PubChem CID77174849
Molecular FormulaC21H16BrClO3
Molecular Weight431.71 g/mol
Exact Mass430.00
IUPAC Name5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride
SMILESO=C(Cl)c1cc(Br)c(OCc2ccccc2)cc1OCc1ccccc1
InChIInChI=1S/C21H16BrClO3/c22-18-11-17(21(23)24)19(25-13-15-7-3-1-4-8-15)12-20(18)26-14-16-9-5-2-6-10-16/h1-12H,13-14H2
InChIKeyFMHAKBRRLBRXRM-UHFFFAOYSA-N
XLogP5.99
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500431.71
LogP ≤ 55.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride?
The IUPAC name of 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride (CID 77174849) is 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride.
What is the SMILES notation for 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride?
The canonical SMILES for 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride is O=C(Cl)c1cc(Br)c(OCc2ccccc2)cc1OCc1ccccc1.
What is the InChIKey of 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride?
The InChIKey is FMHAKBRRLBRXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16BrClO3/c22-18-11-17(21(23)24)19(25-13-15-7-3-1-4-8-15)12-20(18)26-14-16-9-5-2-6-10-16/h1-12H,13-14H2.
What are the key properties of 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride?
5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride has a molecular weight of 431.71 g/mol, XLogP of 5.99, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-bis(phenylmethoxy)benzoyl chloride is sourced from PubChem (CID 77174849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).