C19H21ClO5 — CID 146330375
5-methoxy-4-(3-methoxypropoxy)-2-phenylmethoxybenzoyl chloride (PubChem CID 146330375) has the molecular formula C19H21ClO5 and a molecular weight of 364.83 g/mol. Its IUPAC name is 5-methoxy-4-(3-methoxypropoxy)-2-phenylmethoxybenzoyl chloride.
| Compound Name | 5-methoxy-4-(3-methoxypropoxy)-2-phenylmethoxybenzoyl chloride |
|---|---|
| PubChem CID | 146330375 |
| Molecular Formula | C19H21ClO5 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-methoxy-4-(3-methoxypropoxy)-2-phenylmethoxybenzoyl chloride |
| SMILES | COCCCOc1cc(OCc2ccccc2)c(C(=O)Cl)cc1OC |
| InChI | InChI=1S/C19H21ClO5/c1-22-9-6-10-24-18-12-16(15(19(20)21)11-17(18)23-2)25-13-14-7-4-3-5-8-14/h3-5,7-8,11-12H,6,9-10,13H2,1-2H3 |
| InChIKey | HXWYPALNJUSOGF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|