C18H21BrO3 — CID 135296706
1-bromo-4-(3-methoxypropoxy)-2-methyl-5-phenylmethoxybenzene (PubChem CID 135296706) has the molecular formula C18H21BrO3 and a molecular weight of 365.27 g/mol. Its IUPAC name is 1-bromo-4-(3-methoxypropoxy)-2-methyl-5-phenylmethoxybenzene.
| Compound Name | 1-bromo-4-(3-methoxypropoxy)-2-methyl-5-phenylmethoxybenzene |
|---|---|
| PubChem CID | 135296706 |
| Molecular Formula | C18H21BrO3 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-bromo-4-(3-methoxypropoxy)-2-methyl-5-phenylmethoxybenzene |
| SMILES | COCCCOc1cc(C)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C18H21BrO3/c1-14-11-17(21-10-6-9-20-2)18(12-16(14)19)22-13-15-7-4-3-5-8-15/h3-5,7-8,11-12H,6,9-10,13H2,1-2H3 |
| InChIKey | XXWXSLXRKYCYBC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|