C19H21NO5 — CID 86730354
1-(3-methoxypropoxy)-4-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene (PubChem CID 86730354) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-(3-methoxypropoxy)-4-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene.
| Compound Name | 1-(3-methoxypropoxy)-4-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 86730354 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(3-methoxypropoxy)-4-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene |
| SMILES | COCCCOc1ccc(/C=C/[N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO5/c1-23-12-5-13-24-18-9-8-16(10-11-20(21)22)14-19(18)25-15-17-6-3-2-4-7-17/h2-4,6-11,14H,5,12-13,15H2,1H3/b11-10+ |
| InChIKey | BGCLMRIYUGALHH-ZHACJKMWSA-N |
| XLogP | 3.93 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|