C22H19NO4 — CID 11792933
1-[(E)-2-nitroethenyl]-3,5-bis(phenylmethoxy)benzene (PubChem CID 11792933) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 1-[(E)-2-nitroethenyl]-3,5-bis(phenylmethoxy)benzene.
| Compound Name | 1-[(E)-2-nitroethenyl]-3,5-bis(phenylmethoxy)benzene |
|---|---|
| PubChem CID | 11792933 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-[(E)-2-nitroethenyl]-3,5-bis(phenylmethoxy)benzene |
| SMILES | O=[N+]([O-])/C=C/c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H19NO4/c24-23(25)12-11-20-13-21(26-16-18-7-3-1-4-8-18)15-22(14-20)27-17-19-9-5-2-6-10-19/h1-15H,16-17H2/b12-11+ |
| InChIKey | VLKZULIHYKJZTG-VAWYXSNFSA-N |
| XLogP | 5.09 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|