C17H16ClNO4 — CID 6035841
1-[(3-chlorophenyl)methoxy]-2-ethoxy-4-[(E)-2-nitroethenyl]benzene (PubChem CID 6035841) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methoxy]-2-ethoxy-4-[(E)-2-nitroethenyl]benzene.
| Compound Name | 1-[(3-chlorophenyl)methoxy]-2-ethoxy-4-[(E)-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 6035841 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-[(3-chlorophenyl)methoxy]-2-ethoxy-4-[(E)-2-nitroethenyl]benzene |
| SMILES | CCOc1cc(/C=C/[N+](=O)[O-])ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClNO4/c1-2-22-17-11-13(8-9-19(20)21)6-7-16(17)23-12-14-4-3-5-15(18)10-14/h3-11H,2,12H2,1H3/b9-8+ |
| InChIKey | XPHQQMVPOLOUQB-CMDGGOBGSA-N |
| XLogP | 4.57 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|