C17H14Cl2INO4 — CID 126093911
2-[(3,4-dichlorophenyl)methoxy]-1-ethoxy-3-iodo-5-[(Z)-2-nitroethenyl]benzene (PubChem CID 126093911) has the molecular formula C17H14Cl2INO4 and a molecular weight of 494.11 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methoxy]-1-ethoxy-3-iodo-5-[(Z)-2-nitroethenyl]benzene.
| Compound Name | 2-[(3,4-dichlorophenyl)methoxy]-1-ethoxy-3-iodo-5-[(Z)-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 126093911 |
| Molecular Formula | C17H14Cl2INO4 |
| Molecular Weight | 494.11 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methoxy]-1-ethoxy-3-iodo-5-[(Z)-2-nitroethenyl]benzene |
| SMILES | CCOc1cc(/C=C\[N+](=O)[O-])cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2INO4/c1-2-24-16-9-11(5-6-21(22)23)8-15(20)17(16)25-10-12-3-4-13(18)14(19)7-12/h3-9H,2,10H2,1H3/b6-5- |
| InChIKey | BPDNRVBHQGEEBX-WAYWQWQTSA-N |
| XLogP | 5.82 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.11 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|