C23H22Cl2INO4S — CID 126060164
(5Z)-3-butyl-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126060164) has the molecular formula C23H22Cl2INO4S and a molecular weight of 606.31 g/mol. Its IUPAC name is (5Z)-3-butyl-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-butyl-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126060164 |
| Molecular Formula | C23H22Cl2INO4S |
| Molecular Weight | 606.31 g/mol |
| Exact Mass | 604.97 |
| IUPAC Name | (5Z)-3-butyl-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)S/C(=C\c2cc(I)c(OCc3ccc(Cl)c(Cl)c3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C23H22Cl2INO4S/c1-3-5-8-27-22(28)20(32-23(27)29)12-15-10-18(26)21(19(11-15)30-4-2)31-13-14-6-7-16(24)17(25)9-14/h6-7,9-12H,3-5,8,13H2,1-2H3/b20-12- |
| InChIKey | HQEQVTRCNCVJPD-NDENLUEZSA-N |
| XLogP | 7.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.31 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|