C22H20Cl3NO5S — CID 126135280
(5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126135280) has the molecular formula C22H20Cl3NO5S and a molecular weight of 516.83 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126135280 |
| Molecular Formula | C22H20Cl3NO5S |
| Molecular Weight | 516.83 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | (5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCOC)C2=O)cc(Cl)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl3NO5S/c1-3-30-18-10-14(11-19-21(27)26(6-7-29-2)22(28)32-19)9-17(25)20(18)31-12-13-4-5-15(23)16(24)8-13/h4-5,8-11H,3,6-7,12H2,1-2H3/b19-11+ |
| InChIKey | JOGDCBNSBSPFSK-YBFXNURJSA-N |
| XLogP | 6.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.83 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|