C27H19Cl3N2O4S — CID 126173167
2-[[(5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126173167) has the molecular formula C27H19Cl3N2O4S and a molecular weight of 573.89 g/mol. Its IUPAC name is 2-[[(5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126173167 |
| Molecular Formula | C27H19Cl3N2O4S |
| Molecular Weight | 573.89 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | 2-[[(5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccccc3C#N)C2=O)cc(Cl)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H19Cl3N2O4S/c1-2-35-23-11-17(10-22(30)25(23)36-15-16-7-8-20(28)21(29)9-16)12-24-26(33)32(27(34)37-24)14-19-6-4-3-5-18(19)13-31/h3-12H,2,14-15H2,1H3/b24-12+ |
| InChIKey | HHSWSGBEFBXJKP-WYMPLXKRSA-N |
| XLogP | 7.73 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.89 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|