C27H20ClIN2O4S — CID 126173667
2-[[(5E)-5-[[3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126173667) has the molecular formula C27H20ClIN2O4S and a molecular weight of 630.89 g/mol. Its IUPAC name is 2-[[(5E)-5-[[3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126173667 |
| Molecular Formula | C27H20ClIN2O4S |
| Molecular Weight | 630.89 g/mol |
| Exact Mass | 629.99 |
| IUPAC Name | 2-[[(5E)-5-[[3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccccc3C#N)C2=O)cc(Cl)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C27H20ClIN2O4S/c1-2-34-23-12-18(11-22(28)25(23)35-16-17-7-9-21(29)10-8-17)13-24-26(32)31(27(33)36-24)15-20-6-4-3-5-19(20)14-30/h3-13H,2,15-16H2,1H3/b24-13+ |
| InChIKey | JKIYJMGCRHGGTD-ZMOGYAJESA-N |
| XLogP | 7.03 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.89 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|