C14H9Cl2I2NO2 — CID 91689806
(NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]hydroxylamine (PubChem CID 91689806) has the molecular formula C14H9Cl2I2NO2 and a molecular weight of 547.95 g/mol. Its IUPAC name is (NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 91689806 |
| Molecular Formula | C14H9Cl2I2NO2 |
| Molecular Weight | 547.95 g/mol |
| Exact Mass | 546.81 |
| IUPAC Name | (NZ)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1cc(I)c(OCc2ccc(Cl)c(Cl)c2)c(I)c1 |
| InChI | InChI=1S/C14H9Cl2I2NO2/c15-10-2-1-8(3-11(10)16)7-21-14-12(17)4-9(6-19-20)5-13(14)18/h1-6,20H,7H2/b19-6- |
| InChIKey | AVSVRZVXSAICGA-SWNXQHNESA-N |
| XLogP | 5.59 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.95 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|