C14H10Cl3NO2 — CID 99968453
(NZ)-N-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydroxylamine (PubChem CID 99968453) has the molecular formula C14H10Cl3NO2 and a molecular weight of 330.60 g/mol. Its IUPAC name is (NZ)-N-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 99968453 |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | (NZ)-N-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1cc(Cl)c(OCc2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl3NO2/c15-11-3-1-9(2-4-11)8-20-14-12(16)5-10(7-18-19)6-13(14)17/h1-7,19H,8H2/b18-7- |
| InChIKey | UTBBZZSPMLWLJT-WSVATBPTSA-N |
| XLogP | 5.03 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|