C24H35BrN2O3 — CID 142409271
1-[1-[2-bromo-5-(3-methoxypropoxy)-4-phenylmethoxyphenyl]propyl]-1-tert-butylhydrazine (PubChem CID 142409271) has the molecular formula C24H35BrN2O3 and a molecular weight of 479.46 g/mol. Its IUPAC name is 1-[1-[2-bromo-5-(3-methoxypropoxy)-4-phenylmethoxyphenyl]propyl]-1-tert-butylhydrazine.
| Compound Name | 1-[1-[2-bromo-5-(3-methoxypropoxy)-4-phenylmethoxyphenyl]propyl]-1-tert-butylhydrazine |
|---|---|
| PubChem CID | 142409271 |
| Molecular Formula | C24H35BrN2O3 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-[1-[2-bromo-5-(3-methoxypropoxy)-4-phenylmethoxyphenyl]propyl]-1-tert-butylhydrazine |
| SMILES | CCC(c1cc(OCCCOC)c(OCc2ccccc2)cc1Br)N(N)C(C)(C)C |
| InChI | InChI=1S/C24H35BrN2O3/c1-6-21(27(26)24(2,3)4)19-15-22(29-14-10-13-28-5)23(16-20(19)25)30-17-18-11-8-7-9-12-18/h7-9,11-12,15-16,21H,6,10,13-14,17,26H2,1-5H3 |
| InChIKey | LKUIFPRCNFCLNK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|