C35H42BrNO5Si — CID 68976744
N-[1-(2-bromo-5-methoxy-4-phenylmethoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxybutyl]benzo[f][1,3]benzodioxol-5-amine (PubChem CID 68976744) has the molecular formula C35H42BrNO5Si and a molecular weight of 664.71 g/mol. Its IUPAC name is N-[1-(2-bromo-5-methoxy-4-phenylmethoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxybutyl]benzo[f][1,3]benzodioxol-5-amine.
| Compound Name | N-[1-(2-bromo-5-methoxy-4-phenylmethoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxybutyl]benzo[f][1,3]benzodioxol-5-amine |
|---|---|
| PubChem CID | 68976744 |
| Molecular Formula | C35H42BrNO5Si |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 663.20 |
| IUPAC Name | N-[1-(2-bromo-5-methoxy-4-phenylmethoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxybutyl]benzo[f][1,3]benzodioxol-5-amine |
| SMILES | COc1cc(C(CCCO[Si](C)(C)C(C)(C)C)Nc2cccc3cc4c(cc23)OCO4)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C35H42BrNO5Si/c1-35(2,3)43(5,6)42-17-11-16-30(37-29-15-10-14-25-18-32-33(19-26(25)29)41-23-40-32)27-20-31(38-4)34(21-28(27)36)39-22-24-12-8-7-9-13-24/h7-10,12-15,18-21,30,37H,11,16-17,22-23H2,1-6H3 |
| InChIKey | ONWUMUFGSUFHCG-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|