C22H19NO5 — CID 75453681
N-(1,3-benzodioxol-4-yl)-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 75453681) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-yl)-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-(1,3-benzodioxol-4-yl)-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 75453681 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-(1,3-benzodioxol-4-yl)-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cccc3c2OCO3)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H19NO5/c1-25-20-12-16(10-11-18(20)26-13-15-6-3-2-4-7-15)22(24)23-17-8-5-9-19-21(17)28-14-27-19/h2-12H,13-14H2,1H3,(H,23,24) |
| InChIKey | WPQVUHFPGRHMRD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |