C36H43NO5Si — CID 15518231
tert-butyl-[3-(2-methoxy-12-methyl-1-phenylmethoxy-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)propoxy]-dimethylsilane (PubChem CID 15518231) has the molecular formula C36H43NO5Si and a molecular weight of 597.83 g/mol. Its IUPAC name is tert-butyl-[3-(2-methoxy-12-methyl-1-phenylmethoxy-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-(2-methoxy-12-methyl-1-phenylmethoxy-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15518231 |
| Molecular Formula | C36H43NO5Si |
| Molecular Weight | 597.83 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | tert-butyl-[3-(2-methoxy-12-methyl-1-phenylmethoxy-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)propoxy]-dimethylsilane |
| SMILES | COc1ccc2c(c1OCc1ccccc1)C(CCCO[Si](C)(C)C(C)(C)C)N(C)c1c-2ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C36H43NO5Si/c1-36(2,3)43(6,7)42-19-11-14-29-33-26(17-18-30(38-5)35(33)39-22-24-12-9-8-10-13-24)27-16-15-25-20-31-32(41-23-40-31)21-28(25)34(27)37(29)4/h8-10,12-13,15-18,20-21,29H,11,14,19,22-23H2,1-7H3 |
| InChIKey | GREFHIGYDWSLDV-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.83 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|