C37H42FNO3Si — CID 150361755
tert-butyl-[2-[4-[[3-fluoro-2-(2-methoxyphenyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]ethoxy]-dimethylsilane (PubChem CID 150361755) has the molecular formula C37H42FNO3Si and a molecular weight of 595.83 g/mol. Its IUPAC name is tert-butyl-[2-[4-[[3-fluoro-2-(2-methoxyphenyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[4-[[3-fluoro-2-(2-methoxyphenyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 150361755 |
| Molecular Formula | C37H42FNO3Si |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | tert-butyl-[2-[4-[[3-fluoro-2-(2-methoxyphenyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]ethoxy]-dimethylsilane |
| SMILES | COc1ccccc1-c1c(F)c2cc(OCc3ccccc3)ccc2n1Cc1ccc(CCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H42FNO3Si/c1-37(2,3)43(5,6)42-23-22-27-16-18-28(19-17-27)25-39-33-21-20-30(41-26-29-12-8-7-9-13-29)24-32(33)35(38)36(39)31-14-10-11-15-34(31)40-4/h7-21,24H,22-23,25-26H2,1-6H3 |
| InChIKey | GVVWQBDGKCWKOD-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|