C28H30FNO3 — CID 155635050
2-[4-[[5-butoxy-3-fluoro-2-(4-methoxyphenyl)indol-1-yl]methyl]phenyl]ethanol (PubChem CID 155635050) has the molecular formula C28H30FNO3 and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-[4-[[5-butoxy-3-fluoro-2-(4-methoxyphenyl)indol-1-yl]methyl]phenyl]ethanol.
| Compound Name | 2-[4-[[5-butoxy-3-fluoro-2-(4-methoxyphenyl)indol-1-yl]methyl]phenyl]ethanol |
|---|---|
| PubChem CID | 155635050 |
| Molecular Formula | C28H30FNO3 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[4-[[5-butoxy-3-fluoro-2-(4-methoxyphenyl)indol-1-yl]methyl]phenyl]ethanol |
| SMILES | CCCCOc1ccc2c(c1)c(F)c(-c1ccc(OC)cc1)n2Cc1ccc(CCO)cc1 |
| InChI | InChI=1S/C28H30FNO3/c1-3-4-17-33-24-13-14-26-25(18-24)27(29)28(22-9-11-23(32-2)12-10-22)30(26)19-21-7-5-20(6-8-21)15-16-31/h5-14,18,31H,3-4,15-17,19H2,1-2H3 |
| InChIKey | ZMCVPJVDAXEMSL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|