C24H21ClFNO — CID 161108593
2-[4-[[2-(2-chlorophenyl)-3-fluoro-5-methylindol-1-yl]methyl]phenyl]ethanol (PubChem CID 161108593) has the molecular formula C24H21ClFNO and a molecular weight of 393.89 g/mol. Its IUPAC name is 2-[4-[[2-(2-chlorophenyl)-3-fluoro-5-methylindol-1-yl]methyl]phenyl]ethanol.
| Compound Name | 2-[4-[[2-(2-chlorophenyl)-3-fluoro-5-methylindol-1-yl]methyl]phenyl]ethanol |
|---|---|
| PubChem CID | 161108593 |
| Molecular Formula | C24H21ClFNO |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[4-[[2-(2-chlorophenyl)-3-fluoro-5-methylindol-1-yl]methyl]phenyl]ethanol |
| SMILES | Cc1ccc2c(c1)c(F)c(-c1ccccc1Cl)n2Cc1ccc(CCO)cc1 |
| InChI | InChI=1S/C24H21ClFNO/c1-16-6-11-22-20(14-16)23(26)24(19-4-2-3-5-21(19)25)27(22)15-18-9-7-17(8-10-18)12-13-28/h2-11,14,28H,12-13,15H2,1H3 |
| InChIKey | XMFDYQSMWJQLJJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |