C31H37NO5S — CID 10098655
2-(4-hydroxyphenyl)-3-methyl-1-[[4-(4-pentylsulfonylbutoxy)phenyl]methyl]indol-5-ol (PubChem CID 10098655) has the molecular formula C31H37NO5S and a molecular weight of 535.71 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3-methyl-1-[[4-(4-pentylsulfonylbutoxy)phenyl]methyl]indol-5-ol.
| Compound Name | 2-(4-hydroxyphenyl)-3-methyl-1-[[4-(4-pentylsulfonylbutoxy)phenyl]methyl]indol-5-ol |
|---|---|
| PubChem CID | 10098655 |
| Molecular Formula | C31H37NO5S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3-methyl-1-[[4-(4-pentylsulfonylbutoxy)phenyl]methyl]indol-5-ol |
| SMILES | CCCCCS(=O)(=O)CCCCOc1ccc(Cn2c(-c3ccc(O)cc3)c(C)c3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C31H37NO5S/c1-3-4-6-19-38(35,36)20-7-5-18-37-28-15-8-24(9-16-28)22-32-30-17-14-27(34)21-29(30)23(2)31(32)25-10-12-26(33)13-11-25/h8-17,21,33-34H,3-7,18-20,22H2,1-2H3 |
| InChIKey | LBBVOHBZZWIHBS-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|