C20H21ClN2O3 — CID 135575223
5-chloro-3-nitroso-1-[(4-pentoxyphenyl)methyl]indol-2-ol (PubChem CID 135575223) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 5-chloro-3-nitroso-1-[(4-pentoxyphenyl)methyl]indol-2-ol.
| Compound Name | 5-chloro-3-nitroso-1-[(4-pentoxyphenyl)methyl]indol-2-ol |
|---|---|
| PubChem CID | 135575223 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-chloro-3-nitroso-1-[(4-pentoxyphenyl)methyl]indol-2-ol |
| SMILES | CCCCCOc1ccc(Cn2c(O)c(N=O)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-2-3-4-11-26-16-8-5-14(6-9-16)13-23-18-10-7-15(21)12-17(18)19(22-25)20(23)24/h5-10,12,24H,2-4,11,13H2,1H3 |
| InChIKey | XTJVQQOGZCFNBO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|