C22H26N2O4 — CID 135575083
1-[(3-methoxy-4-pentoxyphenyl)methyl]-7-methyl-3-nitrosoindol-2-ol (PubChem CID 135575083) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[(3-methoxy-4-pentoxyphenyl)methyl]-7-methyl-3-nitrosoindol-2-ol.
| Compound Name | 1-[(3-methoxy-4-pentoxyphenyl)methyl]-7-methyl-3-nitrosoindol-2-ol |
|---|---|
| PubChem CID | 135575083 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[(3-methoxy-4-pentoxyphenyl)methyl]-7-methyl-3-nitrosoindol-2-ol |
| SMILES | CCCCCOc1ccc(Cn2c(O)c(N=O)c3cccc(C)c32)cc1OC |
| InChI | InChI=1S/C22H26N2O4/c1-4-5-6-12-28-18-11-10-16(13-19(18)27-3)14-24-21-15(2)8-7-9-17(21)20(23-26)22(24)25/h7-11,13,25H,4-6,12,14H2,1-3H3 |
| InChIKey | RAFYHIUHNUPQSJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|