C21H33NO4 — CID 54848223
1-[(4-heptoxy-3-methoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 54848223) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[(4-heptoxy-3-methoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(4-heptoxy-3-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 54848223 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-[(4-heptoxy-3-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCCCCCCOc1ccc(CN2CCC(C(=O)O)CC2)cc1OC |
| InChI | InChI=1S/C21H33NO4/c1-3-4-5-6-7-14-26-19-9-8-17(15-20(19)25-2)16-22-12-10-18(11-13-22)21(23)24/h8-9,15,18H,3-7,10-14,16H2,1-2H3,(H,23,24) |
| InChIKey | RCFNKGJUFZBGMD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|