C50H70N2O6 — CID 159731859
ethyl 1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylate;1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 159731859) has the molecular formula C50H70N2O6 and a molecular weight of 795.12 g/mol. Its IUPAC name is ethyl 1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylate;1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | ethyl 1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylate;1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 159731859 |
| Molecular Formula | C50H70N2O6 |
| Molecular Weight | 795.12 g/mol |
| Exact Mass | 794.52 |
| IUPAC Name | ethyl 1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylate;1-[(5-heptoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCCCCCCOc1cccc2cc(CN3CCC(C(=O)O)CC3)ccc12.CCCCCCCOc1cccc2cc(CN3CCC(C(=O)OCC)CC3)ccc12 |
| InChI | InChI=1S/C26H37NO3.C24H33NO3/c1-3-5-6-7-8-18-30-25-11-9-10-23-19-21(12-13-24(23)25)20-27-16-14-22(15-17-27)26(28)29-4-2;1-2-3-4-5-6-16-28-23-9-7-8-21-17-19(10-11-22(21)23)18-25-14-12-20(13-15-25)24(26)27/h9-13,19,22H,3-8,14-18,20H2,1-2H3;7-11,17,20H,2-6,12-16,18H2,1H3,(H,26,27) |
| InChIKey | NBIGQTKWHJHNLQ-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.12 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|