C19H24NO3+ — CID 140661185
[6-[(4-ethoxycarbonylpiperidin-1-yl)methyl]naphthalen-2-yl]oxidanium (PubChem CID 140661185) has the molecular formula C19H24NO3+ and a molecular weight of 314.41 g/mol. Its IUPAC name is [6-[(4-ethoxycarbonylpiperidin-1-yl)methyl]naphthalen-2-yl]oxidanium.
| Compound Name | [6-[(4-ethoxycarbonylpiperidin-1-yl)methyl]naphthalen-2-yl]oxidanium |
|---|---|
| PubChem CID | 140661185 |
| Molecular Formula | C19H24NO3+ |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | [6-[(4-ethoxycarbonylpiperidin-1-yl)methyl]naphthalen-2-yl]oxidanium |
| SMILES | CCOC(=O)C1CCN(Cc2ccc3cc([OH2+])ccc3c2)CC1 |
| InChI | InChI=1S/C19H23NO3/c1-2-23-19(22)15-7-9-20(10-8-15)13-14-3-4-17-12-18(21)6-5-16(17)11-14/h3-6,11-12,15,21H,2,7-10,13H2,1H3/p+1 |
| InChIKey | ZHYQNKOGBGHSQI-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 52.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|