C26H35NO3 — CID 118347020
ethyl 1-[[6-(4-methylcyclohexyl)oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate (PubChem CID 118347020) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is ethyl 1-[[6-(4-methylcyclohexyl)oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[6-(4-methylcyclohexyl)oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 118347020 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | ethyl 1-[[6-(4-methylcyclohexyl)oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2ccc3cc(OC4CCC(C)CC4)ccc3c2)CC1 |
| InChI | InChI=1S/C26H35NO3/c1-3-29-26(28)21-12-14-27(15-13-21)18-20-6-7-23-17-25(11-8-22(23)16-20)30-24-9-4-19(2)5-10-24/h6-8,11,16-17,19,21,24H,3-5,9-10,12-15,18H2,1-2H3 |
| InChIKey | LIDKGHJAIWDGIE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |