C20H24FNO3 — CID 146183475
ethyl 1-[(6-fluorooxynaphthalen-2-yl)methyl]-3-methylpiperidine-4-carboxylate (PubChem CID 146183475) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is ethyl 1-[(6-fluorooxynaphthalen-2-yl)methyl]-3-methylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[(6-fluorooxynaphthalen-2-yl)methyl]-3-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 146183475 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | ethyl 1-[(6-fluorooxynaphthalen-2-yl)methyl]-3-methylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2ccc3cc(OF)ccc3c2)CC1C |
| InChI | InChI=1S/C20H24FNO3/c1-3-24-20(23)19-8-9-22(12-14(19)2)13-15-4-5-17-11-18(25-21)7-6-16(17)10-15/h4-7,10-11,14,19H,3,8-9,12-13H2,1-2H3 |
| InChIKey | ZNQSKBFQWFPJOR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |