C26H31F3INO3 — CID 90051440
ethyl 1-[[5-iodo-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate (PubChem CID 90051440) has the molecular formula C26H31F3INO3 and a molecular weight of 589.44 g/mol. Its IUPAC name is ethyl 1-[[5-iodo-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[5-iodo-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 90051440 |
| Molecular Formula | C26H31F3INO3 |
| Molecular Weight | 589.44 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | ethyl 1-[[5-iodo-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2ccc3c(I)c(OC4CCC(C(F)(F)F)CC4)ccc3c2)CC1 |
| InChI | InChI=1S/C26H31F3INO3/c1-2-33-25(32)18-11-13-31(14-12-18)16-17-3-9-22-19(15-17)4-10-23(24(22)30)34-21-7-5-20(6-8-21)26(27,28)29/h3-4,9-10,15,18,20-21H,2,5-8,11-14,16H2,1H3 |
| InChIKey | RFIREWOMRLNVLF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.44 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|