C25H28F3NO3 — CID 144562283
1-[[5-formyl-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carbaldehyde (PubChem CID 144562283) has the molecular formula C25H28F3NO3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 1-[[5-formyl-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[[5-formyl-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 144562283 |
| Molecular Formula | C25H28F3NO3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[[5-formyl-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methyl]piperidine-4-carbaldehyde |
| SMILES | O=Cc1c(OC2CCC(C(F)(F)F)CC2)ccc2cc(CN3CCC(C=O)CC3)ccc12 |
| InChI | InChI=1S/C25H28F3NO3/c26-25(27,28)20-3-5-21(6-4-20)32-24-8-2-19-13-18(1-7-22(19)23(24)16-31)14-29-11-9-17(15-30)10-12-29/h1-2,7-8,13,15-17,20-21H,3-6,9-12,14H2 |
| InChIKey | DSWXVYKVBZPIOM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|